C16H24F3N5O2 — CID 111050198
1-(3-morpholin-4-ylpropyl)-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine (PubChem CID 111050198) has the molecular formula C16H24F3N5O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropyl)-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-(3-morpholin-4-ylpropyl)-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111050198 |
| Molecular Formula | C16H24F3N5O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-(3-morpholin-4-ylpropyl)-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccnc(OCC(F)(F)F)c1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C16H24F3N5O2/c17-16(18,19)12-26-14-10-13(2-4-21-14)11-23-15(20)22-3-1-5-24-6-8-25-9-7-24/h2,4,10H,1,3,5-9,11-12H2,(H3,20,22,23) |
| InChIKey | JIDAPFGTBVDVFT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|