C18H28F3N5O2 — CID 110971489
1-ethyl-3-(3-morpholin-4-ylpropyl)-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 110971489) has the molecular formula C18H28F3N5O2 and a molecular weight of 403.45 g/mol. Its IUPAC name is 1-ethyl-3-(3-morpholin-4-ylpropyl)-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(3-morpholin-4-ylpropyl)-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 110971489 |
| Molecular Formula | C18H28F3N5O2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 1-ethyl-3-(3-morpholin-4-ylpropyl)-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)nc1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C18H28F3N5O2/c1-2-22-17(23-6-3-7-26-8-10-27-11-9-26)25-13-15-4-5-16(24-12-15)28-14-18(19,20)21/h4-5,12H,2-3,6-11,13-14H2,1H3,(H2,22,23,25) |
| InChIKey | UMGWPWLKOTYQGD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|