C22H27F3N6O — CID 111352056
1-ethyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111352056) has the molecular formula C22H27F3N6O and a molecular weight of 448.49 g/mol. Its IUPAC name is 1-ethyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111352056 |
| Molecular Formula | C22H27F3N6O |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 1-ethyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)nc1)NCCCn1c(C)nc2ccccc21 |
| InChI | InChI=1S/C22H27F3N6O/c1-3-26-21(29-14-17-9-10-20(28-13-17)32-15-22(23,24)25)27-11-6-12-31-16(2)30-18-7-4-5-8-19(18)31/h4-5,7-10,13H,3,6,11-12,14-15H2,1-2H3,(H2,26,27,29) |
| InChIKey | BBLWIBCADSVZOO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|