C19H29F3IN5O — CID 111352383
1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111352383) has the molecular formula C19H29F3IN5O and a molecular weight of 527.37 g/mol. Its IUPAC name is 1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111352383 |
| Molecular Formula | C19H29F3IN5O |
| Molecular Weight | 527.37 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | 1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1c(C)nc2ccccc21)NCCCOCC(F)(F)F.I |
| InChI | InChI=1S/C19H28F3N5O.HI/c1-3-23-18(25-11-7-13-28-14-19(20,21)22)24-10-6-12-27-15(2)26-16-8-4-5-9-17(16)27;/h4-5,8-9H,3,6-7,10-14H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | SEDTWFAQUPAUPW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|