C19H32N6O2S — CID 111353096
1-ethyl-3-[3-(ethylsulfonylamino)propyl]-2-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine (PubChem CID 111353096) has the molecular formula C19H32N6O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is 1-ethyl-3-[3-(ethylsulfonylamino)propyl]-2-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(ethylsulfonylamino)propyl]-2-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111353096 |
| Molecular Formula | C19H32N6O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-ethyl-3-[3-(ethylsulfonylamino)propyl]-2-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCn1c(C)nc2ccccc21)NCCCNS(=O)(=O)CC |
| InChI | InChI=1S/C19H32N6O2S/c1-4-20-19(21-12-8-14-23-28(26,27)5-2)22-13-9-15-25-16(3)24-17-10-6-7-11-18(17)25/h6-7,10-11,23H,4-5,8-9,12-15H2,1-3H3,(H2,20,21,22) |
| InChIKey | PILIRSNRBZXZOG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|