C22H31IN6O2S — CID 111351517
1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111351517) has the molecular formula C22H31IN6O2S and a molecular weight of 570.50 g/mol. Its IUPAC name is 1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111351517 |
| Molecular Formula | C22H31IN6O2S |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | 1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1c(C)nc2ccccc21)NCCc1ccc(S(N)(=O)=O)cc1.I |
| InChI | InChI=1S/C22H30N6O2S.HI/c1-3-24-22(26-15-13-18-9-11-19(12-10-18)31(23,29)30)25-14-6-16-28-17(2)27-20-7-4-5-8-21(20)28;/h4-5,7-12H,3,6,13-16H2,1-2H3,(H2,23,29,30)(H2,24,25,26);1H |
| InChIKey | IGDDSRRMHKIZOP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|