C23H30N6O2 — CID 111351778
N-[2-[[N-ethyl-N'-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]ethyl]-2-hydroxybenzamide (PubChem CID 111351778) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]ethyl]-2-hydroxybenzamide.
| Compound Name | N-[2-[[N-ethyl-N'-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]ethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 111351778 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]ethyl]-2-hydroxybenzamide |
| SMILES | CCN/C(=N\CCCn1c(C)nc2ccccc21)NCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C23H30N6O2/c1-3-24-23(27-15-14-25-22(31)18-9-4-7-12-21(18)30)26-13-8-16-29-17(2)28-19-10-5-6-11-20(19)29/h4-7,9-12,30H,3,8,13-16H2,1-2H3,(H,25,31)(H2,24,26,27) |
| InChIKey | XNJWKKUGSLILDR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|