C19H29F3N4O2 — CID 110973055
1-ethyl-3-(3-morpholin-4-ylpropyl)-2-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 110973055) has the molecular formula C19H29F3N4O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-ethyl-3-(3-morpholin-4-ylpropyl)-2-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(3-morpholin-4-ylpropyl)-2-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 110973055 |
| Molecular Formula | C19H29F3N4O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1-ethyl-3-(3-morpholin-4-ylpropyl)-2-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1OCC(F)(F)F)NCCCN1CCOCC1 |
| InChI | InChI=1S/C19H29F3N4O2/c1-2-23-18(24-8-5-9-26-10-12-27-13-11-26)25-14-16-6-3-4-7-17(16)28-15-19(20,21)22/h3-4,6-7H,2,5,8-15H2,1H3,(H2,23,24,25) |
| InChIKey | SATSOWYQNSQELN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|