C19H32N6O — CID 111041217
1-(3-morpholin-4-ylpropyl)-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 111041217) has the molecular formula C19H32N6O and a molecular weight of 360.51 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropyl)-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 1-(3-morpholin-4-ylpropyl)-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111041217 |
| Molecular Formula | C19H32N6O |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 1-(3-morpholin-4-ylpropyl)-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | N/C(=N\Cc1ccnc(N2CCCCC2)c1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C19H32N6O/c20-19(22-6-4-8-24-11-13-26-14-12-24)23-16-17-5-7-21-18(15-17)25-9-2-1-3-10-25/h5,7,15H,1-4,6,8-14,16H2,(H3,20,22,23) |
| InChIKey | BRVGVQMZZFNHNS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 79.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|