C17H26IN7O — CID 111088472
2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111088472) has the molecular formula C17H26IN7O and a molecular weight of 471.35 g/mol. Its IUPAC name is 2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111088472 |
| Molecular Formula | C17H26IN7O |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccnc(-n2ccnc2)c1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C17H25N7O.HI/c18-17(21-3-1-6-23-8-10-25-11-9-23)22-13-15-2-4-20-16(12-15)24-7-5-19-14-24;/h2,4-5,7,12,14H,1,3,6,8-11,13H2,(H3,18,21,22);1H |
| InChIKey | AFMJRWAPQSXRSZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|