C18H27F3N4O2 — CID 111039001
1-(3-morpholin-4-ylpropyl)-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111039001) has the molecular formula C18H27F3N4O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropyl)-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-(3-morpholin-4-ylpropyl)-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111039001 |
| Molecular Formula | C18H27F3N4O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 1-(3-morpholin-4-ylpropyl)-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(COCC(F)(F)F)cc1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C18H27F3N4O2/c19-18(20,21)14-27-13-16-4-2-15(3-5-16)12-24-17(22)23-6-1-7-25-8-10-26-11-9-25/h2-5H,1,6-14H2,(H3,22,23,24) |
| InChIKey | QMUUYLGVLWAQIS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|