C16H25Cl2F3N4 — CID 22500411
1-(3-pyrrolidin-1-ylpropyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;dihydrochloride (PubChem CID 22500411) has the molecular formula C16H25Cl2F3N4 and a molecular weight of 401.30 g/mol. Its IUPAC name is 1-(3-pyrrolidin-1-ylpropyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;dihydrochloride.
| Compound Name | 1-(3-pyrrolidin-1-ylpropyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 22500411 |
| Molecular Formula | C16H25Cl2F3N4 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 1-(3-pyrrolidin-1-ylpropyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.N/C(=N\Cc1ccc(C(F)(F)F)cc1)NCCCN1CCCC1 |
| InChI | InChI=1S/C16H23F3N4.2ClH/c17-16(18,19)14-6-4-13(5-7-14)12-22-15(20)21-8-3-11-23-9-1-2-10-23;;/h4-7H,1-3,8-12H2,(H3,20,21,22);2*1H |
| InChIKey | XATSPNUQXSSCDN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|