C18H26N6O — CID 111074475
1-(3-morpholin-4-ylpropyl)-2-[(2-pyrazol-1-ylphenyl)methyl]guanidine (PubChem CID 111074475) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropyl)-2-[(2-pyrazol-1-ylphenyl)methyl]guanidine.
| Compound Name | 1-(3-morpholin-4-ylpropyl)-2-[(2-pyrazol-1-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111074475 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-(3-morpholin-4-ylpropyl)-2-[(2-pyrazol-1-ylphenyl)methyl]guanidine |
| SMILES | N/C(=N\Cc1ccccc1-n1cccn1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C18H26N6O/c19-18(20-7-3-9-23-11-13-25-14-12-23)21-15-16-5-1-2-6-17(16)24-10-4-8-22-24/h1-2,4-6,8,10H,3,7,9,11-15H2,(H3,19,20,21) |
| InChIKey | XNYQKQHCFBMFOI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|