C21H33N5OS — CID 9257772
1-(3-morpholin-4-ylpropyl)-3-[(Z)-1-(4-piperidin-1-ylphenyl)ethylideneamino]thiourea (PubChem CID 9257772) has the molecular formula C21H33N5OS and a molecular weight of 403.60 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropyl)-3-[(Z)-1-(4-piperidin-1-ylphenyl)ethylideneamino]thiourea.
| Compound Name | 1-(3-morpholin-4-ylpropyl)-3-[(Z)-1-(4-piperidin-1-ylphenyl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 9257772 |
| Molecular Formula | C21H33N5OS |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 1-(3-morpholin-4-ylpropyl)-3-[(Z)-1-(4-piperidin-1-ylphenyl)ethylideneamino]thiourea |
| SMILES | C/C(=N/NC(=S)NCCCN1CCOCC1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H33N5OS/c1-18(19-6-8-20(9-7-19)26-12-3-2-4-13-26)23-24-21(28)22-10-5-11-25-14-16-27-17-15-25/h6-9H,2-5,10-17H2,1H3,(H2,22,24,28)/b23-18- |
| InChIKey | BDYCPYKNUGJBRD-NKFKGCMQSA-N |
| XLogP | 2.59 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|