C22H29N5O4S2 — CID 6382816
1-[(Z)-1-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]ethylideneamino]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 6382816) has the molecular formula C22H29N5O4S2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 1-[(Z)-1-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]ethylideneamino]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(Z)-1-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]ethylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 6382816 |
| Molecular Formula | C22H29N5O4S2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 1-[(Z)-1-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]ethylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(/C(C)=N\NC(=S)NCCN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C22H29N5O4S2/c1-17(24-25-22(32)23-11-12-27-13-15-31-16-14-27)18-3-9-21(10-4-18)33(28,29)26-19-5-7-20(30-2)8-6-19/h3-10,26H,11-16H2,1-2H3,(H2,23,25,32)/b24-17- |
| InChIKey | HZEGHTKPQQRVOG-ULJHMMPZSA-N |
| XLogP | 2.02 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|