C15H24N4O3S2 — CID 17255659
1-[4-(ethylsulfamoyl)phenyl]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 17255659) has the molecular formula C15H24N4O3S2 and a molecular weight of 372.52 g/mol. Its IUPAC name is 1-[4-(ethylsulfamoyl)phenyl]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[4-(ethylsulfamoyl)phenyl]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 17255659 |
| Molecular Formula | C15H24N4O3S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 1-[4-(ethylsulfamoyl)phenyl]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CCNS(=O)(=O)c1ccc(NC(=S)NCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C15H24N4O3S2/c1-2-17-24(20,21)14-5-3-13(4-6-14)18-15(23)16-7-8-19-9-11-22-12-10-19/h3-6,17H,2,7-12H2,1H3,(H2,16,18,23) |
| InChIKey | IWJLRQFXMLLMPP-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|