C16H25N5O2S2 — CID 8618749
1-(4-ethoxyphenyl)-3-(2-morpholin-4-ylethylcarbamothioylamino)thiourea (PubChem CID 8618749) has the molecular formula C16H25N5O2S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-(2-morpholin-4-ylethylcarbamothioylamino)thiourea.
| Compound Name | 1-(4-ethoxyphenyl)-3-(2-morpholin-4-ylethylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 8618749 |
| Molecular Formula | C16H25N5O2S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-(2-morpholin-4-ylethylcarbamothioylamino)thiourea |
| SMILES | CCOc1ccc(NC(=S)NNC(=S)NCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C16H25N5O2S2/c1-2-23-14-5-3-13(4-6-14)18-16(25)20-19-15(24)17-7-8-21-9-11-22-12-10-21/h3-6H,2,7-12H2,1H3,(H2,17,19,24)(H2,18,20,25) |
| InChIKey | YWFFYHFMPMFTBJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 69.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|