C14H28N6O2S2 — CID 2974218
1-(2-morpholin-4-ylethyl)-3-(2-morpholin-4-ylethylcarbamothioylamino)thiourea (PubChem CID 2974218) has the molecular formula C14H28N6O2S2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-3-(2-morpholin-4-ylethylcarbamothioylamino)thiourea.
| Compound Name | 1-(2-morpholin-4-ylethyl)-3-(2-morpholin-4-ylethylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 2974218 |
| Molecular Formula | C14H28N6O2S2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-3-(2-morpholin-4-ylethylcarbamothioylamino)thiourea |
| SMILES | S=C(NCCN1CCOCC1)NNC(=S)NCCN1CCOCC1 |
| InChI | InChI=1S/C14H28N6O2S2/c23-13(15-1-3-19-5-9-21-10-6-19)17-18-14(24)16-2-4-20-7-11-22-12-8-20/h1-12H2,(H2,15,17,23)(H2,16,18,24) |
| InChIKey | RBYOUMVXUFYCNV-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|