C15H21FN4O2S — CID 8657307
1-[(4-fluorobenzoyl)amino]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 8657307) has the molecular formula C15H21FN4O2S and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-[(4-fluorobenzoyl)amino]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(4-fluorobenzoyl)amino]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 8657307 |
| Molecular Formula | C15H21FN4O2S |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-[(4-fluorobenzoyl)amino]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | O=C(NNC(=S)NCCCN1CCOCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FN4O2S/c16-13-4-2-12(3-5-13)14(21)18-19-15(23)17-6-1-7-20-8-10-22-11-9-20/h2-5H,1,6-11H2,(H,18,21)(H2,17,19,23) |
| InChIKey | CKGKTMKUVXJPAQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|