C24H32N4O3S — CID 19581697
1-[[4-[(3,4-dimethylphenoxy)methyl]benzoyl]amino]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 19581697) has the molecular formula C24H32N4O3S and a molecular weight of 456.61 g/mol. Its IUPAC name is 1-[[4-[(3,4-dimethylphenoxy)methyl]benzoyl]amino]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[[4-[(3,4-dimethylphenoxy)methyl]benzoyl]amino]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 19581697 |
| Molecular Formula | C24H32N4O3S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 1-[[4-[(3,4-dimethylphenoxy)methyl]benzoyl]amino]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1ccc(OCc2ccc(C(=O)NNC(=S)NCCCN3CCOCC3)cc2)cc1C |
| InChI | InChI=1S/C24H32N4O3S/c1-18-4-9-22(16-19(18)2)31-17-20-5-7-21(8-6-20)23(29)26-27-24(32)25-10-3-11-28-12-14-30-15-13-28/h4-9,16H,3,10-15,17H2,1-2H3,(H,26,29)(H2,25,27,32) |
| InChIKey | FYIUIJPYYAKQRW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|