C13H27N5OS2 — CID 8789670
1-(3-methylbutyl)-3-(2-morpholin-4-ylethylcarbamothioylamino)thiourea (PubChem CID 8789670) has the molecular formula C13H27N5OS2 and a molecular weight of 333.53 g/mol. Its IUPAC name is 1-(3-methylbutyl)-3-(2-morpholin-4-ylethylcarbamothioylamino)thiourea.
| Compound Name | 1-(3-methylbutyl)-3-(2-morpholin-4-ylethylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 8789670 |
| Molecular Formula | C13H27N5OS2 |
| Molecular Weight | 333.53 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 1-(3-methylbutyl)-3-(2-morpholin-4-ylethylcarbamothioylamino)thiourea |
| SMILES | CC(C)CCNC(=S)NNC(=S)NCCN1CCOCC1 |
| InChI | InChI=1S/C13H27N5OS2/c1-11(2)3-4-14-12(20)16-17-13(21)15-5-6-18-7-9-19-10-8-18/h11H,3-10H2,1-2H3,(H2,14,16,20)(H2,15,17,21) |
| InChIKey | PYIGKBFATKCAOS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 60.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.53 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|