C26H52N2O2 — CID 54522748
3,7,11,15-tetramethyl-N-(2-morpholin-4-ylethyl)hexadecanamide (PubChem CID 54522748) has the molecular formula C26H52N2O2 and a molecular weight of 424.71 g/mol. Its IUPAC name is 3,7,11,15-tetramethyl-N-(2-morpholin-4-ylethyl)hexadecanamide.
| Compound Name | 3,7,11,15-tetramethyl-N-(2-morpholin-4-ylethyl)hexadecanamide |
|---|---|
| PubChem CID | 54522748 |
| Molecular Formula | C26H52N2O2 |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.40 |
| IUPAC Name | 3,7,11,15-tetramethyl-N-(2-morpholin-4-ylethyl)hexadecanamide |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C26H52N2O2/c1-22(2)9-6-10-23(3)11-7-12-24(4)13-8-14-25(5)21-26(29)27-15-16-28-17-19-30-20-18-28/h22-25H,6-21H2,1-5H3,(H,27,29) |
| InChIKey | YQZILAFISDWISY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |