C11H23NO3 — CID 172564161
formic acid;4-(4-methylpentyl)morpholine (PubChem CID 172564161) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is formic acid;4-(4-methylpentyl)morpholine.
| Compound Name | formic acid;4-(4-methylpentyl)morpholine |
|---|---|
| PubChem CID | 172564161 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | formic acid;4-(4-methylpentyl)morpholine |
| SMILES | CC(C)CCCN1CCOCC1.O=CO |
| InChI | InChI=1S/C10H21NO.CH2O2/c1-10(2)4-3-5-11-6-8-12-9-7-11;2-1-3/h10H,3-9H2,1-2H3;1H,(H,2,3) |
| InChIKey | IWJGVSSYJTUSER-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|