C15H34N2O — CID 176932414
N,N-dimethylpropan-1-amine;4-(4-methylpentyl)morpholine (PubChem CID 176932414) has the molecular formula C15H34N2O and a molecular weight of 258.45 g/mol. Its IUPAC name is N,N-dimethylpropan-1-amine;4-(4-methylpentyl)morpholine.
| Compound Name | N,N-dimethylpropan-1-amine;4-(4-methylpentyl)morpholine |
|---|---|
| PubChem CID | 176932414 |
| Molecular Formula | C15H34N2O |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.27 |
| IUPAC Name | N,N-dimethylpropan-1-amine;4-(4-methylpentyl)morpholine |
| SMILES | CC(C)CCCN1CCOCC1.CCCN(C)C |
| InChI | InChI=1S/C10H21NO.C5H13N/c1-10(2)4-3-5-11-6-8-12-9-7-11;1-4-5-6(2)3/h10H,3-9H2,1-2H3;4-5H2,1-3H3 |
| InChIKey | VBSDLVUYGPWCKI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |