C16H36N2O — CID 142615810
4-(4-methylpentyl)morpholine;N,N,2-trimethylpropan-1-amine (PubChem CID 142615810) has the molecular formula C16H36N2O and a molecular weight of 272.48 g/mol. Its IUPAC name is 4-(4-methylpentyl)morpholine;N,N,2-trimethylpropan-1-amine.
| Compound Name | 4-(4-methylpentyl)morpholine;N,N,2-trimethylpropan-1-amine |
|---|---|
| PubChem CID | 142615810 |
| Molecular Formula | C16H36N2O |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.28 |
| IUPAC Name | 4-(4-methylpentyl)morpholine;N,N,2-trimethylpropan-1-amine |
| SMILES | CC(C)CCCN1CCOCC1.CC(C)CN(C)C |
| InChI | InChI=1S/C10H21NO.C6H15N/c1-10(2)4-3-5-11-6-8-12-9-7-11;1-6(2)5-7(3)4/h10H,3-9H2,1-2H3;6H,5H2,1-4H3 |
| InChIKey | ATQOLBIGVMNEHI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |