C12H26Cl2N2O — CID 22403187
4-(2-chloroethyl)morpholine;3-chloro-N,N,2-trimethylpropan-1-amine (PubChem CID 22403187) has the molecular formula C12H26Cl2N2O and a molecular weight of 285.26 g/mol. Its IUPAC name is 4-(2-chloroethyl)morpholine;3-chloro-N,N,2-trimethylpropan-1-amine.
| Compound Name | 4-(2-chloroethyl)morpholine;3-chloro-N,N,2-trimethylpropan-1-amine |
|---|---|
| PubChem CID | 22403187 |
| Molecular Formula | C12H26Cl2N2O |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 4-(2-chloroethyl)morpholine;3-chloro-N,N,2-trimethylpropan-1-amine |
| SMILES | CC(CCl)CN(C)C.ClCCN1CCOCC1 |
| InChI | InChI=1S/C6H12ClNO.C6H14ClN/c7-1-2-8-3-5-9-6-4-8;1-6(4-7)5-8(2)3/h1-6H2;6H,4-5H2,1-3H3 |
| InChIKey | NPZHQSUFDYYQGA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|