C8H18Cl2N2OZn — CID 70152362
zinc;N,N-dimethyl-2-morpholin-4-ylethanamine;dichloride (PubChem CID 70152362) has the molecular formula C8H18Cl2N2OZn and a molecular weight of 294.54 g/mol. Its IUPAC name is zinc;N,N-dimethyl-2-morpholin-4-ylethanamine;dichloride.
| Compound Name | zinc;N,N-dimethyl-2-morpholin-4-ylethanamine;dichloride |
|---|---|
| PubChem CID | 70152362 |
| Molecular Formula | C8H18Cl2N2OZn |
| Molecular Weight | 294.54 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | zinc;N,N-dimethyl-2-morpholin-4-ylethanamine;dichloride |
| SMILES | CN(C)CCN1CCOCC1.[Cl-].[Cl-].[Zn+2] |
| InChI | InChI=1S/C8H18N2O.2ClH.Zn/c1-9(2)3-4-10-5-7-11-8-6-10;;;/h3-8H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | CGFNRUFDGVCPJM-UHFFFAOYSA-L |
| XLogP | -6.11 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.54 |
| LogP ≤ 5 | -6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|