C11H25N3O — CID 28583738
N',N'-dimethyl-N-(2-morpholin-4-ylethyl)propane-1,3-diamine (PubChem CID 28583738) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is N',N'-dimethyl-N-(2-morpholin-4-ylethyl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(2-morpholin-4-ylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 28583738 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | N',N'-dimethyl-N-(2-morpholin-4-ylethyl)propane-1,3-diamine |
| SMILES | CN(C)CCCNCCN1CCOCC1 |
| InChI | InChI=1S/C11H25N3O/c1-13(2)6-3-4-12-5-7-14-8-10-15-11-9-14/h12H,3-11H2,1-2H3 |
| InChIKey | SSRSZUSUQODMJL-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|