C11H24N4O2 — CID 83120439
1,1-dimethyl-3-[2-(2-morpholin-4-ylethylamino)ethyl]urea (PubChem CID 83120439) has the molecular formula C11H24N4O2 and a molecular weight of 244.34 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-(2-morpholin-4-ylethylamino)ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-(2-morpholin-4-ylethylamino)ethyl]urea |
|---|---|
| PubChem CID | 83120439 |
| Molecular Formula | C11H24N4O2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1,1-dimethyl-3-[2-(2-morpholin-4-ylethylamino)ethyl]urea |
| SMILES | CN(C)C(=O)NCCNCCN1CCOCC1 |
| InChI | InChI=1S/C11H24N4O2/c1-14(2)11(16)13-4-3-12-5-6-15-7-9-17-10-8-15/h12H,3-10H2,1-2H3,(H,13,16) |
| InChIKey | IKNICURCINQIRT-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|