C13H27N3O2 — CID 110445097
1,1-diethyl-3-(4-morpholin-4-ylbutyl)urea (PubChem CID 110445097) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 1,1-diethyl-3-(4-morpholin-4-ylbutyl)urea.
| Compound Name | 1,1-diethyl-3-(4-morpholin-4-ylbutyl)urea |
|---|---|
| PubChem CID | 110445097 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 1,1-diethyl-3-(4-morpholin-4-ylbutyl)urea |
| SMILES | CCN(CC)C(=O)NCCCCN1CCOCC1 |
| InChI | InChI=1S/C13H27N3O2/c1-3-16(4-2)13(17)14-7-5-6-8-15-9-11-18-12-10-15/h3-12H2,1-2H3,(H,14,17) |
| InChIKey | CZEHTPVLMTTYRJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|