C12H23N3O3 — CID 108517535
N',N'-diethyl-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 108517535) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is N',N'-diethyl-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N',N'-diethyl-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108517535 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | N',N'-diethyl-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | CCN(CC)C(=O)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C12H23N3O3/c1-3-15(4-2)12(17)11(16)13-5-6-14-7-9-18-10-8-14/h3-10H2,1-2H3,(H,13,16) |
| InChIKey | ATSXVMJAZYIQHL-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|