C15H31N5O2 — CID 75532926
N,N-diethyl-3-[[N'-methyl-N-(2-morpholin-4-ylethyl)carbamimidoyl]amino]propanamide (PubChem CID 75532926) has the molecular formula C15H31N5O2 and a molecular weight of 313.45 g/mol. Its IUPAC name is N,N-diethyl-3-[[N'-methyl-N-(2-morpholin-4-ylethyl)carbamimidoyl]amino]propanamide.
| Compound Name | N,N-diethyl-3-[[N'-methyl-N-(2-morpholin-4-ylethyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 75532926 |
| Molecular Formula | C15H31N5O2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | N,N-diethyl-3-[[N'-methyl-N-(2-morpholin-4-ylethyl)carbamimidoyl]amino]propanamide |
| SMILES | CCN(CC)C(=O)CCN/C(=N\C)NCCN1CCOCC1 |
| InChI | InChI=1S/C15H31N5O2/c1-4-20(5-2)14(21)6-7-17-15(16-3)18-8-9-19-10-12-22-13-11-19/h4-13H2,1-3H3,(H2,16,17,18) |
| InChIKey | OEIBXLVWURPHQQ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|