C16H32IN5O2 — CID 111079328
N-cyclopentyl-3-[[N'-methyl-N-(2-morpholin-4-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111079328) has the molecular formula C16H32IN5O2 and a molecular weight of 453.37 g/mol. Its IUPAC name is N-cyclopentyl-3-[[N'-methyl-N-(2-morpholin-4-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-cyclopentyl-3-[[N'-methyl-N-(2-morpholin-4-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111079328 |
| Molecular Formula | C16H32IN5O2 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-cyclopentyl-3-[[N'-methyl-N-(2-morpholin-4-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)NC1CCCC1)NCCN1CCOCC1.I |
| InChI | InChI=1S/C16H31N5O2.HI/c1-17-16(19-8-9-21-10-12-23-13-11-21)18-7-6-15(22)20-14-4-2-3-5-14;/h14H,2-13H2,1H3,(H,20,22)(H2,17,18,19);1H |
| InChIKey | CCVIDYNTKNYAQO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|