C14H28N4O — CID 111226709
N-cyclohexyl-3-[(N'-methyl-N-propylcarbamimidoyl)amino]propanamide (PubChem CID 111226709) has the molecular formula C14H28N4O and a molecular weight of 268.40 g/mol. Its IUPAC name is N-cyclohexyl-3-[(N'-methyl-N-propylcarbamimidoyl)amino]propanamide.
| Compound Name | N-cyclohexyl-3-[(N'-methyl-N-propylcarbamimidoyl)amino]propanamide |
|---|---|
| PubChem CID | 111226709 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | N-cyclohexyl-3-[(N'-methyl-N-propylcarbamimidoyl)amino]propanamide |
| SMILES | CCCN/C(=N\C)NCCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H28N4O/c1-3-10-16-14(15-2)17-11-9-13(19)18-12-7-5-4-6-8-12/h12H,3-11H2,1-2H3,(H,18,19)(H2,15,16,17) |
| InChIKey | SEBZCUHYOHQIQX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|