C8H17N5O — CID 104882342
3-[(N-amino-N'-methylcarbamimidoyl)amino]-N-cyclopropylpropanamide (PubChem CID 104882342) has the molecular formula C8H17N5O and a molecular weight of 199.26 g/mol. Its IUPAC name is 3-[(N-amino-N'-methylcarbamimidoyl)amino]-N-cyclopropylpropanamide.
| Compound Name | 3-[(N-amino-N'-methylcarbamimidoyl)amino]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 104882342 |
| Molecular Formula | C8H17N5O |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 3-[(N-amino-N'-methylcarbamimidoyl)amino]-N-cyclopropylpropanamide |
| SMILES | C/N=C(\NN)NCCC(=O)NC1CC1 |
| InChI | InChI=1S/C8H17N5O/c1-10-8(13-9)11-5-4-7(14)12-6-2-3-6/h6H,2-5,9H2,1H3,(H,12,14)(H2,10,11,13) |
| InChIKey | ASDWGGYIHBMYQF-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|