C5H13IN4 — CID 67070956
1-amino-3-cyclopropyl-2-methylguanidine;hydroiodide (PubChem CID 67070956) has the molecular formula C5H13IN4 and a molecular weight of 256.09 g/mol. Its IUPAC name is 1-amino-3-cyclopropyl-2-methylguanidine;hydroiodide.
| Compound Name | 1-amino-3-cyclopropyl-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 67070956 |
| Molecular Formula | C5H13IN4 |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 1-amino-3-cyclopropyl-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NN)NC1CC1.I |
| InChI | InChI=1S/C5H12N4.HI/c1-7-5(9-6)8-4-2-3-4;/h4H,2-3,6H2,1H3,(H2,7,8,9);1H |
| InChIKey | XUVGHYBKLYNWEN-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|