C7H14FN3 — CID 130774185
1-cyclopropyl-3-(2-fluoroethyl)-2-methylguanidine (PubChem CID 130774185) has the molecular formula C7H14FN3 and a molecular weight of 159.21 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2-fluoroethyl)-2-methylguanidine.
| Compound Name | 1-cyclopropyl-3-(2-fluoroethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 130774185 |
| Molecular Formula | C7H14FN3 |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.12 |
| IUPAC Name | 1-cyclopropyl-3-(2-fluoroethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCCF)NC1CC1 |
| InChI | InChI=1S/C7H14FN3/c1-9-7(10-5-4-8)11-6-2-3-6/h6H,2-5H2,1H3,(H2,9,10,11) |
| InChIKey | WSGRKHRYWDYCHF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|