C10H18F3N3S — CID 119116672
1-cyclopentyl-2-methyl-3-[2-(trifluoromethylsulfanyl)ethyl]guanidine (PubChem CID 119116672) has the molecular formula C10H18F3N3S and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-cyclopentyl-2-methyl-3-[2-(trifluoromethylsulfanyl)ethyl]guanidine.
| Compound Name | 1-cyclopentyl-2-methyl-3-[2-(trifluoromethylsulfanyl)ethyl]guanidine |
|---|---|
| PubChem CID | 119116672 |
| Molecular Formula | C10H18F3N3S |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-cyclopentyl-2-methyl-3-[2-(trifluoromethylsulfanyl)ethyl]guanidine |
| SMILES | C/N=C(\NCCSC(F)(F)F)NC1CCCC1 |
| InChI | InChI=1S/C10H18F3N3S/c1-14-9(16-8-4-2-3-5-8)15-6-7-17-10(11,12)13/h8H,2-7H2,1H3,(H2,14,15,16) |
| InChIKey | JIIJGZXCKIFWIH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|