C12H23N3 — CID 95760513
1-(cyclohexylmethyl)-3-cyclopropyl-2-methylguanidine (PubChem CID 95760513) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-3-cyclopropyl-2-methylguanidine.
| Compound Name | 1-(cyclohexylmethyl)-3-cyclopropyl-2-methylguanidine |
|---|---|
| PubChem CID | 95760513 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 1-(cyclohexylmethyl)-3-cyclopropyl-2-methylguanidine |
| SMILES | C/N=C(\NCC1CCCCC1)NC1CC1 |
| InChI | InChI=1S/C12H23N3/c1-13-12(15-11-7-8-11)14-9-10-5-3-2-4-6-10/h10-11H,2-9H2,1H3,(H2,13,14,15) |
| InChIKey | PIMFEDVMUNDPTB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|