C17H33IN4 — CID 119150585
1-(cyclopentylmethyl)-3-(1-cyclopentylpyrrolidin-3-yl)-2-methylguanidine;hydroiodide (PubChem CID 119150585) has the molecular formula C17H33IN4 and a molecular weight of 420.38 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-3-(1-cyclopentylpyrrolidin-3-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-(cyclopentylmethyl)-3-(1-cyclopentylpyrrolidin-3-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119150585 |
| Molecular Formula | C17H33IN4 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 1-(cyclopentylmethyl)-3-(1-cyclopentylpyrrolidin-3-yl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCCC1)NC1CCN(C2CCCC2)C1.I |
| InChI | InChI=1S/C17H32N4.HI/c1-18-17(19-12-14-6-2-3-7-14)20-15-10-11-21(13-15)16-8-4-5-9-16;/h14-16H,2-13H2,1H3,(H2,18,19,20);1H |
| InChIKey | MWOQZRVJIYWLSX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|