C25H41N5O — CID 111919697
1-(1-cyclopentylpyrrolidin-3-yl)-3-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]-2-methylguanidine (PubChem CID 111919697) has the molecular formula C25H41N5O and a molecular weight of 427.64 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrrolidin-3-yl)-3-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]-2-methylguanidine.
| Compound Name | 1-(1-cyclopentylpyrrolidin-3-yl)-3-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111919697 |
| Molecular Formula | C25H41N5O |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.33 |
| IUPAC Name | 1-(1-cyclopentylpyrrolidin-3-yl)-3-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCC1CCN(Cc2ccc(OC)cc2)CC1)NC1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C25H41N5O/c1-26-25(28-22-13-16-30(19-22)23-5-3-4-6-23)27-17-20-11-14-29(15-12-20)18-21-7-9-24(31-2)10-8-21/h7-10,20,22-23H,3-6,11-19H2,1-2H3,(H2,26,27,28) |
| InChIKey | PQODUVHXRYDCRJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|