C12H23F3IN3 — CID 111778538
2-methyl-1-(4-methylcyclohexyl)-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111778538) has the molecular formula C12H23F3IN3 and a molecular weight of 393.24 g/mol. Its IUPAC name is 2-methyl-1-(4-methylcyclohexyl)-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(4-methylcyclohexyl)-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111778538 |
| Molecular Formula | C12H23F3IN3 |
| Molecular Weight | 393.24 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-methyl-1-(4-methylcyclohexyl)-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NC1CCC(C)CC1.I |
| InChI | InChI=1S/C12H22F3N3.HI/c1-9-3-5-10(6-4-9)18-11(16-2)17-8-7-12(13,14)15;/h9-10H,3-8H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | NNPVFIUTUROLQI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|