C15H32N4 — CID 111764337
1-[2-(tert-butylamino)ethyl]-2-methyl-3-(4-methylcyclohexyl)guanidine (PubChem CID 111764337) has the molecular formula C15H32N4 and a molecular weight of 268.45 g/mol. Its IUPAC name is 1-[2-(tert-butylamino)ethyl]-2-methyl-3-(4-methylcyclohexyl)guanidine.
| Compound Name | 1-[2-(tert-butylamino)ethyl]-2-methyl-3-(4-methylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 111764337 |
| Molecular Formula | C15H32N4 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | 1-[2-(tert-butylamino)ethyl]-2-methyl-3-(4-methylcyclohexyl)guanidine |
| SMILES | C/N=C(\NCCNC(C)(C)C)NC1CCC(C)CC1 |
| InChI | InChI=1S/C15H32N4/c1-12-6-8-13(9-7-12)19-14(16-5)17-10-11-18-15(2,3)4/h12-13,18H,6-11H2,1-5H3,(H2,16,17,19) |
| InChIKey | RUJWTUPQEKVCNX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|