C16H35IN4 — CID 111257086
1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methyl-3-(4-methylcyclohexyl)guanidine;hydroiodide (PubChem CID 111257086) has the molecular formula C16H35IN4 and a molecular weight of 410.39 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methyl-3-(4-methylcyclohexyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methyl-3-(4-methylcyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111257086 |
| Molecular Formula | C16H35IN4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methyl-3-(4-methylcyclohexyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)(C)CN(C)C)NC1CCC(C)CC1.I |
| InChI | InChI=1S/C16H34N4.HI/c1-13-7-9-14(10-8-13)19-15(17-4)18-11-16(2,3)12-20(5)6;/h13-14H,7-12H2,1-6H3,(H2,17,18,19);1H |
| InChIKey | VDUMCYDBGYBWIB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|