C11H23N3S — CID 86811847
1-cyclopropyl-3-[3-(dimethylamino)-2,2-dimethylpropyl]thiourea (PubChem CID 86811847) has the molecular formula C11H23N3S and a molecular weight of 229.39 g/mol. Its IUPAC name is 1-cyclopropyl-3-[3-(dimethylamino)-2,2-dimethylpropyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[3-(dimethylamino)-2,2-dimethylpropyl]thiourea |
|---|---|
| PubChem CID | 86811847 |
| Molecular Formula | C11H23N3S |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 1-cyclopropyl-3-[3-(dimethylamino)-2,2-dimethylpropyl]thiourea |
| SMILES | CN(C)CC(C)(C)CNC(=S)NC1CC1 |
| InChI | InChI=1S/C11H23N3S/c1-11(2,8-14(3)4)7-12-10(15)13-9-5-6-9/h9H,5-8H2,1-4H3,(H2,12,13,15) |
| InChIKey | CUEFPHDKXJVBPW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|