C16H25N3OS — CID 18230092
1-(4-acetylphenyl)-3-[3-(dimethylamino)-2,2-dimethylpropyl]thiourea (PubChem CID 18230092) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[3-(dimethylamino)-2,2-dimethylpropyl]thiourea.
| Compound Name | 1-(4-acetylphenyl)-3-[3-(dimethylamino)-2,2-dimethylpropyl]thiourea |
|---|---|
| PubChem CID | 18230092 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[3-(dimethylamino)-2,2-dimethylpropyl]thiourea |
| SMILES | CC(=O)c1ccc(NC(=S)NCC(C)(C)CN(C)C)cc1 |
| InChI | InChI=1S/C16H25N3OS/c1-12(20)13-6-8-14(9-7-13)18-15(21)17-10-16(2,3)11-19(4)5/h6-9H,10-11H2,1-5H3,(H2,17,18,21) |
| InChIKey | DMVAQPNRUXDVJB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|