C16H27N3S — CID 8615986
1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-(4-ethylphenyl)thiourea (PubChem CID 8615986) has the molecular formula C16H27N3S and a molecular weight of 293.48 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-(4-ethylphenyl)thiourea.
| Compound Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-(4-ethylphenyl)thiourea |
|---|---|
| PubChem CID | 8615986 |
| Molecular Formula | C16H27N3S |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-(4-ethylphenyl)thiourea |
| SMILES | CCc1ccc(NC(=S)NCC(C)(C)CN(C)C)cc1 |
| InChI | InChI=1S/C16H27N3S/c1-6-13-7-9-14(10-8-13)18-15(20)17-11-16(2,3)12-19(4)5/h7-10H,6,11-12H2,1-5H3,(H2,17,18,20) |
| InChIKey | NFHIHLGAYYYCNO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|