C12H16Cl2N2S — CID 54758020
1-(3,4-dichlorophenyl)-3-(2,2-dimethylpropyl)thiourea (PubChem CID 54758020) has the molecular formula C12H16Cl2N2S and a molecular weight of 291.25 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(2,2-dimethylpropyl)thiourea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(2,2-dimethylpropyl)thiourea |
|---|---|
| PubChem CID | 54758020 |
| Molecular Formula | C12H16Cl2N2S |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(2,2-dimethylpropyl)thiourea |
| SMILES | CC(C)(C)CNC(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2S/c1-12(2,3)7-15-11(17)16-8-4-5-9(13)10(14)6-8/h4-6H,7H2,1-3H3,(H2,15,16,17) |
| InChIKey | PDASXNMQFHOBCK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|