C17H25ClFN3S — CID 21008709
1-[2-(azepan-1-yl)-2-methylpropyl]-3-(3-chloro-4-fluorophenyl)thiourea (PubChem CID 21008709) has the molecular formula C17H25ClFN3S and a molecular weight of 357.93 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)-2-methylpropyl]-3-(3-chloro-4-fluorophenyl)thiourea.
| Compound Name | 1-[2-(azepan-1-yl)-2-methylpropyl]-3-(3-chloro-4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 21008709 |
| Molecular Formula | C17H25ClFN3S |
| Molecular Weight | 357.93 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-[2-(azepan-1-yl)-2-methylpropyl]-3-(3-chloro-4-fluorophenyl)thiourea |
| SMILES | CC(C)(CNC(=S)Nc1ccc(F)c(Cl)c1)N1CCCCCC1 |
| InChI | InChI=1S/C17H25ClFN3S/c1-17(2,22-9-5-3-4-6-10-22)12-20-16(23)21-13-7-8-15(19)14(18)11-13/h7-8,11H,3-6,9-10,12H2,1-2H3,(H2,20,21,23) |
| InChIKey | WJRPHLALWRZYKJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.93 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|