C18H21ClFN3OS — CID 8788006
1-(3-chloro-4-fluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea (PubChem CID 8788006) has the molecular formula C18H21ClFN3OS and a molecular weight of 381.90 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 8788006 |
| Molecular Formula | C18H21ClFN3OS |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea |
| SMILES | Fc1ccc(NC(=S)NC[C@@H](c2ccco2)N2CCCCC2)cc1Cl |
| InChI | InChI=1S/C18H21ClFN3OS/c19-14-11-13(6-7-15(14)20)22-18(25)21-12-16(17-5-4-10-24-17)23-8-2-1-3-9-23/h4-7,10-11,16H,1-3,8-9,12H2,(H2,21,22,25)/t16-/m0/s1 |
| InChIKey | XULQTUFFBSDQIX-INIZCTEOSA-N |
| XLogP | 4.59 |
| TPSA | 40.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|